![4-[4-(2-methoxyphenyl)piperazin-1-yl]butan-1-amine (CAS: 21103-33-3) - Chemical Structure and Molecular Formula](/static/img/prod_pic/FT-0709274.png "4-[4-(2-methoxyphenyl)piperazin-1-yl]butan-1-amine chemical structure")
4-[4-(2-methoxyphenyl)piperazin-1-yl]butan-1-amine
Catalog No: FT-0709274
CAS No: 21103-33-3
- Chemical Name: 4-[4-(2-methoxyphenyl)piperazin-1-yl]butan-1-amine
- Molecular Formula: C15H25N3O
- Molecular Weight: 263.38
- InChI Key: UFJPFLDFMPVGRW-UHFFFAOYSA-N
- InChI: InChI=1S/C15H25N3O/c1-19-15-7-3-2-6-14(15)18-12-10-17(11-13-18)9-5-4-8-16/h2-3,6-7H,4-5,8-13,16H2,1H3
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| CAS: | 21103-33-3 |
|---|---|
| MF: | C15H25N3O |
| Density: | 1.049g/cm3 |
| Flash_Point: | 199.04ºC |
| Melting_Point: | N/A |
| Product_Name: | 4-[4-(2-methoxyphenyl)piperazin-1-yl]butan-1-amine |
| Symbol: | GHS05 |
| Bolling_Point: | 405.501ºC at 760 mmHg |
| FW: | 263.37800 |
| Bolling_Point: | 405.501ºC at 760 mmHg |
|---|---|
| Density: | 1.049g/cm3 |
| MF: | C15H25N3O |
| LogP: | 2.25930 |
| Exact_Mass: | 263.20000 |
| Vapor_Pressure: | 0mmHg at 25°C |
| Flash_Point: | 199.04ºC |
| FW: | 263.37800 |
| Refractive_Index: | 1.541 |
| PSA: | 41.73000 |
| Safety_Statements: | H314 |
|---|---|
| Symbol: | GHS05 |
| Warning_Statement: | P280-P305 + P351 + P338-P310 |
| HS_Code: | 2933599090 |
| RIDADR: | UN 2735PSN1 8 / PGII |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)